C33H32P2 — CID 101070950
[(1S)-1-[2-[(1S)-1-diphenylphosphanylethyl]cyclopenta-1,3-dien-1-yl]ethyl]-diphenylphosphane (PubChem CID 101070950) has the molecular formula C33H32P2 and a molecular weight of 490.57 g/mol. Its IUPAC name is [(1S)-1-[2-[(1S)-1-diphenylphosphanylethyl]cyclopenta-1,3-dien-1-yl]ethyl]-diphenylphosphane.
| Compound Name | [(1S)-1-[2-[(1S)-1-diphenylphosphanylethyl]cyclopenta-1,3-dien-1-yl]ethyl]-diphenylphosphane |
|---|---|
| PubChem CID | 101070950 |
| Molecular Formula | C33H32P2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(1S)-1-[2-[(1S)-1-diphenylphosphanylethyl]cyclopenta-1,3-dien-1-yl]ethyl]-diphenylphosphane |
| SMILES | C[C@@H](C1=C([C@H](C)P(c2ccccc2)c2ccccc2)CC=C1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32P2/c1-26(34(28-16-7-3-8-17-28)29-18-9-4-10-19-29)32-24-15-25-33(32)27(2)35(30-20-11-5-12-21-30)31-22-13-6-14-23-31/h3-24,26-27H,25H2,1-2H3/t26-,27-/m0/s1 |
| InChIKey | OQSTYLMNNBVWGO-SVBPBHIXSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|