C13H24 — CID 162105362
1,2-di(propan-2-yl)cyclopenta-1,3-diene;ethane (PubChem CID 162105362) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)cyclopenta-1,3-diene;ethane.
| Compound Name | 1,2-di(propan-2-yl)cyclopenta-1,3-diene;ethane |
|---|---|
| PubChem CID | 162105362 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,2-di(propan-2-yl)cyclopenta-1,3-diene;ethane |
| SMILES | CC.CC(C)C1=C(C(C)C)CC=C1 |
| InChI | InChI=1S/C11H18.C2H6/c1-8(2)10-6-5-7-11(10)9(3)4;1-2/h5-6,8-9H,7H2,1-4H3;1-2H3 |
| InChIKey | ZFKYZXMMDUEFLV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |