C13H21N — CID 162270844
2-methylidene-6,7-di(propan-2-yl)-1,3-dihydroazepine (PubChem CID 162270844) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-methylidene-6,7-di(propan-2-yl)-1,3-dihydroazepine.
| Compound Name | 2-methylidene-6,7-di(propan-2-yl)-1,3-dihydroazepine |
|---|---|
| PubChem CID | 162270844 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-methylidene-6,7-di(propan-2-yl)-1,3-dihydroazepine |
| SMILES | C=C1CC=CC(C(C)C)=C(C(C)C)N1 |
| InChI | InChI=1S/C13H21N/c1-9(2)12-8-6-7-11(5)14-13(12)10(3)4/h6,8-10,14H,5,7H2,1-4H3 |
| InChIKey | SBONESPXDOCESS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |