C10H18Si — CID 102435122
dimethyl-(2-propan-2-ylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 102435122) has the molecular formula C10H18Si and a molecular weight of 166.34 g/mol. Its IUPAC name is dimethyl-(2-propan-2-ylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | dimethyl-(2-propan-2-ylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 102435122 |
| Molecular Formula | C10H18Si |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | dimethyl-(2-propan-2-ylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC(C)C1=C([SiH](C)C)CC=C1 |
| InChI | InChI=1S/C10H18Si/c1-8(2)9-6-5-7-10(9)11(3)4/h5-6,8,11H,7H2,1-4H3 |
| InChIKey | HHXUOPXMIQSCPI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|