About 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene
6-methylidene-2-propan-2-ylcyclohexa-1,3-diene (PubChem CID 90709253) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene.
Analyze 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene?
The IUPAC name of 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene (CID 90709253) is 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene.
What is the SMILES notation for 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene?
The canonical SMILES for 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene is C=C1C=C(C(C)C)C=CC1.
What is the InChIKey of 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene?
The InChIKey is YALXMFRBGMUIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-8(2)10-6-4-5-9(3)7-10/h4,6-8H,3,5H2,1-2H3.
What are the key properties of 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene?
6-methylidene-2-propan-2-ylcyclohexa-1,3-diene has a molecular weight of 134.22 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-2-propan-2-ylcyclohexa-1,3-diene is sourced from PubChem (CID 90709253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).