C10H12O2 — CID 130031149
4-propan-2-ylcyclohepta-3,6-diene-1,2-dione (PubChem CID 130031149) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 4-propan-2-ylcyclohepta-3,6-diene-1,2-dione.
| Compound Name | 4-propan-2-ylcyclohepta-3,6-diene-1,2-dione |
|---|---|
| PubChem CID | 130031149 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-propan-2-ylcyclohepta-3,6-diene-1,2-dione |
| SMILES | CC(C)C1=CC(=O)C(=O)C=CC1 |
| InChI | InChI=1S/C10H12O2/c1-7(2)8-4-3-5-9(11)10(12)6-8/h3,5-7H,4H2,1-2H3 |
| InChIKey | GQSMWHRIGVEYKW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|