C13H14S — CID 145149614
6-methylidene-2-phenylcyclohexa-1,3-diene;sulfane (PubChem CID 145149614) has the molecular formula C13H14S and a molecular weight of 202.32 g/mol. Its IUPAC name is 6-methylidene-2-phenylcyclohexa-1,3-diene;sulfane.
| Compound Name | 6-methylidene-2-phenylcyclohexa-1,3-diene;sulfane |
|---|---|
| PubChem CID | 145149614 |
| Molecular Formula | C13H14S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 6-methylidene-2-phenylcyclohexa-1,3-diene;sulfane |
| SMILES | C=C1C=C(c2ccccc2)C=CC1.S |
| InChI | InChI=1S/C13H12.H2S/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;/h2-5,7-10H,1,6H2;1H2 |
| InChIKey | UKQMFWNTFUVSJZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |