C39H32F12P2 — CID 88976943
[(1R)-1-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]ethyl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 88976943) has the molecular formula C39H32F12P2 and a molecular weight of 790.61 g/mol. Its IUPAC name is [(1R)-1-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]ethyl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [(1R)-1-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]ethyl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 88976943 |
| Molecular Formula | C39H32F12P2 |
| Molecular Weight | 790.61 g/mol |
| Exact Mass | 790.18 |
| IUPAC Name | [(1R)-1-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]ethyl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)[C@H](C)C2=C(P(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C=CC2)c1 |
| InChI | InChI=1S/C39H32F12P2/c1-21-9-22(2)12-30(11-21)52(31-13-23(3)10-24(4)14-31)25(5)34-7-6-8-35(34)53(32-17-26(36(40,41)42)15-27(18-32)37(43,44)45)33-19-28(38(46,47)48)16-29(20-33)39(49,50)51/h6,8-20,25H,7H2,1-5H3/t25-/m1/s1 |
| InChIKey | ZFAAVIQRHVOWQB-RUZDIDTESA-N |
| XLogP | 12.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.61 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|