C21H40NP — CID 140666053
(1R)-1-[2-[cyclohexyl(cyclopentyl)phosphanyl]-3-methylcyclopentyl]-N,N-dimethylethanamine (PubChem CID 140666053) has the molecular formula C21H40NP and a molecular weight of 337.53 g/mol. Its IUPAC name is (1R)-1-[2-[cyclohexyl(cyclopentyl)phosphanyl]-3-methylcyclopentyl]-N,N-dimethylethanamine.
| Compound Name | (1R)-1-[2-[cyclohexyl(cyclopentyl)phosphanyl]-3-methylcyclopentyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 140666053 |
| Molecular Formula | C21H40NP |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.29 |
| IUPAC Name | (1R)-1-[2-[cyclohexyl(cyclopentyl)phosphanyl]-3-methylcyclopentyl]-N,N-dimethylethanamine |
| SMILES | CC1CCC([C@@H](C)N(C)C)C1P(C1CCCCC1)C1CCCC1 |
| InChI | InChI=1S/C21H40NP/c1-16-14-15-20(17(2)22(3)4)21(16)23(19-12-8-9-13-19)18-10-6-5-7-11-18/h16-21H,5-15H2,1-4H3/t16?,17-,20?,21?,23?/m1/s1 |
| InChIKey | CIAJJOTTYJVTEO-OYECOOIQSA-N |
| XLogP | 6.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|