About silane;tricyclohexylphosphane
silane;tricyclohexylphosphane (PubChem CID 158384701) has the molecular formula C18H37PSi
and a molecular weight of 312.55 g/mol. Its IUPAC name is silane;tricyclohexylphosphane.
Molecular Properties
| Compound Name | silane;tricyclohexylphosphane |
| PubChem CID | 158384701 |
| Molecular Formula | C18H37PSi |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | silane;tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.[SiH4] |
| InChI | InChI=1S/C18H33P.H4Si/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;1H4 |
| InChIKey | GWFMPEXWWYANIN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze silane;tricyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;tricyclohexylphosphane?
The IUPAC name of silane;tricyclohexylphosphane (CID 158384701) is silane;tricyclohexylphosphane.
What is the SMILES notation for silane;tricyclohexylphosphane?
The canonical SMILES for silane;tricyclohexylphosphane is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.[SiH4].
What is the InChIKey of silane;tricyclohexylphosphane?
The InChIKey is GWFMPEXWWYANIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33P.H4Si/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;1H4.
What are the key properties of silane;tricyclohexylphosphane?
silane;tricyclohexylphosphane has a molecular weight of 312.55 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for silane;tricyclohexylphosphane is sourced from PubChem (CID 158384701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).