About phosphane;tricyclohexylphosphane
phosphane;tricyclohexylphosphane (PubChem CID 87084185) has the molecular formula C18H36P2
and a molecular weight of 314.43 g/mol. Its IUPAC name is phosphane;tricyclohexylphosphane.
Molecular Properties
| Compound Name | phosphane;tricyclohexylphosphane |
| PubChem CID | 87084185 |
| Molecular Formula | C18H36P2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | phosphane;tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.P |
| InChI | InChI=1S/C18H33P.H3P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;1H3 |
| InChIKey | MRSDSBMESKXSNZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphane;tricyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;tricyclohexylphosphane?
The IUPAC name of phosphane;tricyclohexylphosphane (CID 87084185) is phosphane;tricyclohexylphosphane.
What is the SMILES notation for phosphane;tricyclohexylphosphane?
The canonical SMILES for phosphane;tricyclohexylphosphane is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.P.
What is the InChIKey of phosphane;tricyclohexylphosphane?
The InChIKey is MRSDSBMESKXSNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33P.H3P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;1H3.
What are the key properties of phosphane;tricyclohexylphosphane?
phosphane;tricyclohexylphosphane has a molecular weight of 314.43 g/mol, XLogP of 6.52, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;tricyclohexylphosphane is sourced from PubChem (CID 87084185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).