About gold(1+);tricyclohexylphosphane
gold(1+);tricyclohexylphosphane (PubChem CID 161082953) has the molecular formula C18H33AuP+
and a molecular weight of 477.40 g/mol. Its IUPAC name is gold(1+);tricyclohexylphosphane.
Molecular Properties
| Compound Name | gold(1+);tricyclohexylphosphane |
| PubChem CID | 161082953 |
| Molecular Formula | C18H33AuP+ |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | gold(1+);tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.[Au+] |
| InChI | InChI=1S/C18H33P.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;/q;+1 |
| InChIKey | UGDKEOQHOBOPKM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);tricyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);tricyclohexylphosphane?
The IUPAC name of gold(1+);tricyclohexylphosphane (CID 161082953) is gold(1+);tricyclohexylphosphane.
What is the SMILES notation for gold(1+);tricyclohexylphosphane?
The canonical SMILES for gold(1+);tricyclohexylphosphane is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.[Au+].
What is the InChIKey of gold(1+);tricyclohexylphosphane?
The InChIKey is UGDKEOQHOBOPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33P.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;/q;+1.
What are the key properties of gold(1+);tricyclohexylphosphane?
gold(1+);tricyclohexylphosphane has a molecular weight of 477.40 g/mol, XLogP of 6.46, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);tricyclohexylphosphane is sourced from PubChem (CID 161082953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).