C10H22NP — CID 123849739
(1R)-N,N-dimethyl-1-(3-methyl-2-phosphanylcyclopentyl)ethanamine (PubChem CID 123849739) has the molecular formula C10H22NP and a molecular weight of 187.27 g/mol. Its IUPAC name is (1R)-N,N-dimethyl-1-(3-methyl-2-phosphanylcyclopentyl)ethanamine.
| Compound Name | (1R)-N,N-dimethyl-1-(3-methyl-2-phosphanylcyclopentyl)ethanamine |
|---|---|
| PubChem CID | 123849739 |
| Molecular Formula | C10H22NP |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | (1R)-N,N-dimethyl-1-(3-methyl-2-phosphanylcyclopentyl)ethanamine |
| SMILES | CC1CCC([C@@H](C)N(C)C)C1P |
| InChI | InChI=1S/C10H22NP/c1-7-5-6-9(10(7)12)8(2)11(3)4/h7-10H,5-6,12H2,1-4H3/t7?,8-,9?,10?/m1/s1 |
| InChIKey | IMVCRTPVAPCADB-FVKBGGDRSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|