C28H42NP2- — CID 134959452
(1S)-1-[2-[(2-dicyclohexylphosphanylphenyl)-methylphosphanyl]cyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine (PubChem CID 134959452) has the molecular formula C28H42NP2- and a molecular weight of 454.60 g/mol. Its IUPAC name is (1S)-1-[2-[(2-dicyclohexylphosphanylphenyl)-methylphosphanyl]cyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine.
| Compound Name | (1S)-1-[2-[(2-dicyclohexylphosphanylphenyl)-methylphosphanyl]cyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 134959452 |
| Molecular Formula | C28H42NP2- |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (1S)-1-[2-[(2-dicyclohexylphosphanylphenyl)-methylphosphanyl]cyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine |
| SMILES | C[C@@H]([c-]1cccc1[P@@](C)c1ccccc1P(C1CCCCC1)C1CCCCC1)N(C)C |
| InChI | InChI=1S/C28H42NP2/c1-22(29(2)3)25-18-13-21-26(25)30(4)27-19-11-12-20-28(27)31(23-14-7-5-8-15-23)24-16-9-6-10-17-24/h11-13,18-24H,5-10,14-17H2,1-4H3/q-1/t22-,30+/m0/s1 |
| InChIKey | LRTFKPJRIZTNOE-SMSORMJASA-N |
| XLogP | 6.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|