C9H13BrN- — CID 164665887
(1R)-1-(2-bromocyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine (PubChem CID 164665887) has the molecular formula C9H13BrN- and a molecular weight of 215.11 g/mol. Its IUPAC name is (1R)-1-(2-bromocyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine.
| Compound Name | (1R)-1-(2-bromocyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 164665887 |
| Molecular Formula | C9H13BrN- |
| Molecular Weight | 215.11 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | (1R)-1-(2-bromocyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine |
| SMILES | C[C@H]([c-]1cccc1Br)N(C)C |
| InChI | InChI=1S/C9H13BrN/c1-7(11(2)3)8-5-4-6-9(8)10/h4-7H,1-3H3/q-1/t7-/m1/s1 |
| InChIKey | ITMUJIVAVLSIPG-SSDOTTSWSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|