C43H63FeNP2-6 — CID 174614732
cyclopentane;(1R)-1-(2,3-dicyclohexyl-5-phosphanylcyclopenta-2,4-dien-1-yl)-1-(2-dicyclohexylphosphanylphenyl)-N,N-dimethylmethanamine;iron (PubChem CID 174614732) has the molecular formula C43H63FeNP2-6 and a molecular weight of 711.78 g/mol. Its IUPAC name is cyclopentane;(1R)-1-(2,3-dicyclohexyl-5-phosphanylcyclopenta-2,4-dien-1-yl)-1-(2-dicyclohexylphosphanylphenyl)-N,N-dimethylmethanamine;iron.
| Compound Name | cyclopentane;(1R)-1-(2,3-dicyclohexyl-5-phosphanylcyclopenta-2,4-dien-1-yl)-1-(2-dicyclohexylphosphanylphenyl)-N,N-dimethylmethanamine;iron |
|---|---|
| PubChem CID | 174614732 |
| Molecular Formula | C43H63FeNP2-6 |
| Molecular Weight | 711.78 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | cyclopentane;(1R)-1-(2,3-dicyclohexyl-5-phosphanylcyclopenta-2,4-dien-1-yl)-1-(2-dicyclohexylphosphanylphenyl)-N,N-dimethylmethanamine;iron |
| SMILES | CN(C)[C@@H](c1ccccc1P(C1CCCCC1)C1CCCCC1)[c-]1c(P)cc(C2CCCCC2)c1C1CCCCC1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C38H58NP2.C5H5.Fe/c1-39(2)38(37-34(40)27-33(28-17-7-3-8-18-28)36(37)29-19-9-4-10-20-29)32-25-15-16-26-35(32)41(30-21-11-5-12-22-30)31-23-13-6-14-24-31;1-2-4-5-3-1;/h15-16,25-31,38H,3-14,17-24,40H2,1-2H3;1-5H;/q-1;-5;/t38-;;/m0../s1 |
| InChIKey | NSXGIXLPBDLABC-ZCLNGFLVSA-N |
| XLogP | 11.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.78 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|