C30H44NOPS — CID 154725985
N-[(R)-(2-dicyclohexylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 154725985) has the molecular formula C30H44NOPS and a molecular weight of 497.73 g/mol. Its IUPAC name is N-[(R)-(2-dicyclohexylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | N-[(R)-(2-dicyclohexylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 154725985 |
| Molecular Formula | C30H44NOPS |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | N-[(R)-(2-dicyclohexylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | CN([C@H](c1ccccc1)c1ccccc1P(C1CCCCC1)C1CCCCC1)S(=O)C(C)(C)C |
| InChI | InChI=1S/C30H44NOPS/c1-30(2,3)34(32)31(4)29(24-16-8-5-9-17-24)27-22-14-15-23-28(27)33(25-18-10-6-11-19-25)26-20-12-7-13-21-26/h5,8-9,14-17,22-23,25-26,29H,6-7,10-13,18-21H2,1-4H3/t29-,34?/m1/s1 |
| InChIKey | JQOGHPACTGDYMR-QMUARQKKSA-N |
| XLogP | 7.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|