C30H44NO2PS — CID 166597654
(S)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 166597654) has the molecular formula C30H44NO2PS and a molecular weight of 513.73 g/mol. Its IUPAC name is (S)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 166597654 |
| Molecular Formula | C30H44NO2PS |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (S)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1ccc([C@H](N[S@@](=O)C(C)(C)C)c2ccccc2P(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H44NO2PS/c1-30(2,3)35(32)31-29(23-19-21-24(33-4)22-20-23)27-17-11-12-18-28(27)34(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h11-12,17-22,25-26,29,31H,5-10,13-16H2,1-4H3/t29-,35-/m0/s1 |
| InChIKey | AMJUUQQEJOWQMC-YTWZBVJHSA-N |
| XLogP | 7.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|