C31H46NOPS — CID 156620879
(R)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(3,5-dimethylphenyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 156620879) has the molecular formula C31H46NOPS and a molecular weight of 511.76 g/mol. Its IUPAC name is (R)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(3,5-dimethylphenyl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(3,5-dimethylphenyl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 156620879 |
| Molecular Formula | C31H46NOPS |
| Molecular Weight | 511.76 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | (R)-N-[(S)-(2-dicyclohexylphosphanylphenyl)-(3,5-dimethylphenyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cc(C)cc([C@H](N[S@](=O)C(C)(C)C)c2ccccc2P(C2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H46NOPS/c1-23-20-24(2)22-25(21-23)30(32-35(33)31(3,4)5)28-18-12-13-19-29(28)34(26-14-8-6-9-15-26)27-16-10-7-11-17-27/h12-13,18-22,26-27,30,32H,6-11,14-17H2,1-5H3/t30-,35+/m0/s1 |
| InChIKey | NHUAWUXOLWAPAD-LWQYYNMXSA-N |
| XLogP | 8.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.76 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|