C32H42F6NOPS — CID 156620896
(R)-N-[(S)-[3,5-bis(trifluoromethyl)phenyl]-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 156620896) has the molecular formula C32H42F6NOPS and a molecular weight of 633.72 g/mol. Its IUPAC name is (R)-N-[(S)-[3,5-bis(trifluoromethyl)phenyl]-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(S)-[3,5-bis(trifluoromethyl)phenyl]-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 156620896 |
| Molecular Formula | C32H42F6NOPS |
| Molecular Weight | 633.72 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | (R)-N-[(S)-[3,5-bis(trifluoromethyl)phenyl]-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | CN([C@@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1P(C1CCCCC1)C1CCCCC1)[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C32H42F6NOPS/c1-30(2,3)42(40)39(4)29(22-19-23(31(33,34)35)21-24(20-22)32(36,37)38)27-17-11-12-18-28(27)41(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h11-12,17-21,25-26,29H,5-10,13-16H2,1-4H3/t29-,42+/m0/s1 |
| InChIKey | YEPMBIRTVRUNCS-KVBUJHEKSA-N |
| XLogP | 9.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.72 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|