C30H32NOPS — CID 155293926
(R)-N-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 155293926) has the molecular formula C30H32NOPS and a molecular weight of 485.63 g/mol. Its IUPAC name is (R)-N-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 155293926 |
| Molecular Formula | C30H32NOPS |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (R)-N-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | CN([C@H](c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1)[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C30H32NOPS/c1-30(2,3)34(32)31(4)29(24-16-8-5-9-17-24)27-22-14-15-23-28(27)33(25-18-10-6-11-19-25)26-20-12-7-13-21-26/h5-23,29H,1-4H3/t29-,34-/m1/s1 |
| InChIKey | YCLRTNBFAFWZQH-ANHUGMMASA-N |
| XLogP | 5.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|