C32H36NOPS — CID 162393839
N-[(R)-(3,5-dimethylphenyl)-(2-diphenylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 162393839) has the molecular formula C32H36NOPS and a molecular weight of 513.69 g/mol. Its IUPAC name is N-[(R)-(3,5-dimethylphenyl)-(2-diphenylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | N-[(R)-(3,5-dimethylphenyl)-(2-diphenylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162393839 |
| Molecular Formula | C32H36NOPS |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | N-[(R)-(3,5-dimethylphenyl)-(2-diphenylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | Cc1cc(C)cc([C@H](c2ccccc2P(c2ccccc2)c2ccccc2)N(C)S(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C32H36NOPS/c1-24-21-25(2)23-26(22-24)31(33(6)36(34)32(3,4)5)29-19-13-14-20-30(29)35(27-15-9-7-10-16-27)28-17-11-8-12-18-28/h7-23,31H,1-6H3/t31-,36?/m1/s1 |
| InChIKey | INELIXLRNPBNLZ-RACIXVTASA-N |
| XLogP | 6.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|