C35H34NO3PS — CID 155885272
N-[(R)-(6-diphenylphosphanyl-1,3-benzodioxol-5-yl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 155885272) has the molecular formula C35H34NO3PS and a molecular weight of 579.70 g/mol. Its IUPAC name is N-[(R)-(6-diphenylphosphanyl-1,3-benzodioxol-5-yl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | N-[(R)-(6-diphenylphosphanyl-1,3-benzodioxol-5-yl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 155885272 |
| Molecular Formula | C35H34NO3PS |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | N-[(R)-(6-diphenylphosphanyl-1,3-benzodioxol-5-yl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | CN([C@@H](c1cc2c(cc1P(c1ccccc1)c1ccccc1)OCO2)c1cccc2ccccc12)S(=O)C(C)(C)C |
| InChI | InChI=1S/C35H34NO3PS/c1-35(2,3)41(37)36(4)34(29-21-13-15-25-14-11-12-20-28(25)29)30-22-31-32(39-24-38-31)23-33(30)40(26-16-7-5-8-17-26)27-18-9-6-10-19-27/h5-23,34H,24H2,1-4H3/t34-,41?/m1/s1 |
| InChIKey | GGIJOJJRUYYYEK-MPDQCYFASA-N |
| XLogP | 6.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|