C31H24O4 — CID 121278678
2-(1,3-benzodioxol-5-yl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid (PubChem CID 121278678) has the molecular formula C31H24O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 121278678 |
| Molecular Formula | C31H24O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid |
| SMILES | CC(C(=O)O)(c1ccc2c(c1)OCO2)C(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H24O4/c1-31(30(32)33,22-16-17-27-28(18-22)35-19-34-27)29(25-14-6-10-20-8-2-4-12-23(20)25)26-15-7-11-21-9-3-5-13-24(21)26/h2-18,29H,19H2,1H3,(H,32,33) |
| InChIKey | MNFSDGBWMXAPEZ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |