C28H22O2S — CID 121278715
(2R)-2-methyl-3,3-dinaphthalen-1-yl-2-thiophen-3-ylpropanoic acid (PubChem CID 121278715) has the molecular formula C28H22O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is (2R)-2-methyl-3,3-dinaphthalen-1-yl-2-thiophen-3-ylpropanoic acid.
| Compound Name | (2R)-2-methyl-3,3-dinaphthalen-1-yl-2-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 121278715 |
| Molecular Formula | C28H22O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (2R)-2-methyl-3,3-dinaphthalen-1-yl-2-thiophen-3-ylpropanoic acid |
| SMILES | C[C@](C(=O)O)(c1ccsc1)C(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H22O2S/c1-28(27(29)30,21-16-17-31-18-21)26(24-14-6-10-19-8-2-4-12-22(19)24)25-15-7-11-20-9-3-5-13-23(20)25/h2-18,26H,1H3,(H,29,30)/t28-/m0/s1 |
| InChIKey | BDRKRDWYLOETLP-NDEPHWFRSA-N |
| XLogP | 7.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |