C19H21NS — CID 141116798
N,N-dimethyl-3-naphthalen-1-yl-3-thiophen-3-ylpropan-1-amine (PubChem CID 141116798) has the molecular formula C19H21NS and a molecular weight of 295.45 g/mol. Its IUPAC name is N,N-dimethyl-3-naphthalen-1-yl-3-thiophen-3-ylpropan-1-amine.
| Compound Name | N,N-dimethyl-3-naphthalen-1-yl-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 141116798 |
| Molecular Formula | C19H21NS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N,N-dimethyl-3-naphthalen-1-yl-3-thiophen-3-ylpropan-1-amine |
| SMILES | CN(C)CCC(c1ccsc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H21NS/c1-20(2)12-10-18(16-11-13-21-14-16)19-9-5-7-15-6-3-4-8-17(15)19/h3-9,11,13-14,18H,10,12H2,1-2H3 |
| InChIKey | XDZISUMJPLUOOG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |