C30H23BrO2 — CID 121278721
(2R)-2-(2-bromophenyl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid (PubChem CID 121278721) has the molecular formula C30H23BrO2 and a molecular weight of 495.42 g/mol. Its IUPAC name is (2R)-2-(2-bromophenyl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid.
| Compound Name | (2R)-2-(2-bromophenyl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 121278721 |
| Molecular Formula | C30H23BrO2 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | (2R)-2-(2-bromophenyl)-2-methyl-3,3-dinaphthalen-1-ylpropanoic acid |
| SMILES | C[C@](C(=O)O)(c1ccccc1Br)C(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H23BrO2/c1-30(29(32)33,26-18-6-7-19-27(26)31)28(24-16-8-12-20-10-2-4-14-22(20)24)25-17-9-13-21-11-3-5-15-23(21)25/h2-19,28H,1H3,(H,32,33)/t30-/m0/s1 |
| InChIKey | XYNLNBOTTKYGNJ-PMERELPUSA-N |
| XLogP | 7.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |