C19H17NO2 — CID 22299281
1-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylethanamine (PubChem CID 22299281) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylethanamine |
|---|---|
| PubChem CID | 22299281 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylethanamine |
| SMILES | CC(N)(c1ccc2c(c1)OCO2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H17NO2/c1-19(20,16-8-9-17-18(11-16)22-12-21-17)15-7-6-13-4-2-3-5-14(13)10-15/h2-11H,12,20H2,1H3 |
| InChIKey | PGEYTSLBZURUAT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |