C10H10N2O2 — CID 30116351
(2R)-2-amino-2-(1,3-benzodioxol-5-yl)propanenitrile (PubChem CID 30116351) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2R)-2-amino-2-(1,3-benzodioxol-5-yl)propanenitrile.
| Compound Name | (2R)-2-amino-2-(1,3-benzodioxol-5-yl)propanenitrile |
|---|---|
| PubChem CID | 30116351 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (2R)-2-amino-2-(1,3-benzodioxol-5-yl)propanenitrile |
| SMILES | C[C@](N)(C#N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10N2O2/c1-10(12,5-11)7-2-3-8-9(4-7)14-6-13-8/h2-4H,6,12H2,1H3/t10-/m0/s1 |
| InChIKey | DRVWDUJHDYZISK-JTQLQIEISA-N |
| XLogP | 1.11 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |