C10H13NO4 — CID 162733869
2-amino-1-(1,3-benzodioxol-5-yl)propane-1,1-diol (PubChem CID 162733869) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-amino-1-(1,3-benzodioxol-5-yl)propane-1,1-diol.
| Compound Name | 2-amino-1-(1,3-benzodioxol-5-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 162733869 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-amino-1-(1,3-benzodioxol-5-yl)propane-1,1-diol |
| SMILES | CC(N)C(O)(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13NO4/c1-6(11)10(12,13)7-2-3-8-9(4-7)15-5-14-8/h2-4,6,12-13H,5,11H2,1H3 |
| InChIKey | RXPZIQXKWCBGKJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|