C12H18O9P2 — CID 11748942
1,3-benzodioxol-5-yl-bis(dimethoxyphosphoryl)methanol (PubChem CID 11748942) has the molecular formula C12H18O9P2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-bis(dimethoxyphosphoryl)methanol.
| Compound Name | 1,3-benzodioxol-5-yl-bis(dimethoxyphosphoryl)methanol |
|---|---|
| PubChem CID | 11748942 |
| Molecular Formula | C12H18O9P2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 1,3-benzodioxol-5-yl-bis(dimethoxyphosphoryl)methanol |
| SMILES | COP(=O)(OC)C(O)(c1ccc2c(c1)OCO2)P(=O)(OC)OC |
| InChI | InChI=1S/C12H18O9P2/c1-16-22(14,17-2)12(13,23(15,18-3)19-4)9-5-6-10-11(7-9)21-8-20-10/h5-7,13H,8H2,1-4H3 |
| InChIKey | ZJLLAQSOQLJQPN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|