C12H14O3 — CID 97294109
(1S)-1-(1,3-benzodioxol-5-yl)-1-cyclopropylethanol (PubChem CID 97294109) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)-1-cyclopropylethanol.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)-1-cyclopropylethanol |
|---|---|
| PubChem CID | 97294109 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)-1-cyclopropylethanol |
| SMILES | C[C@@](O)(c1ccc2c(c1)OCO2)C1CC1 |
| InChI | InChI=1S/C12H14O3/c1-12(13,8-2-3-8)9-4-5-10-11(6-9)15-7-14-10/h4-6,8,13H,2-3,7H2,1H3/t12-/m0/s1 |
| InChIKey | WJYBNXLYSXQJNR-LBPRGKRZSA-N |
| XLogP | 2.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |