C13H17NO2 — CID 83837134
2-(1,3-benzodioxol-5-yl)-2-cyclopropylpropan-1-amine (PubChem CID 83837134) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-cyclopropylpropan-1-amine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-cyclopropylpropan-1-amine |
|---|---|
| PubChem CID | 83837134 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-cyclopropylpropan-1-amine |
| SMILES | CC(CN)(c1ccc2c(c1)OCO2)C1CC1 |
| InChI | InChI=1S/C13H17NO2/c1-13(7-14,9-2-3-9)10-4-5-11-12(6-10)16-8-15-11/h4-6,9H,2-3,7-8,14H2,1H3 |
| InChIKey | XWAHWRLVGMAEBD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |