C30H42NOPS — CID 164887404
(R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 164887404) has the molecular formula C30H42NOPS and a molecular weight of 495.71 g/mol. Its IUPAC name is (R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 164887404 |
| Molecular Formula | C30H42NOPS |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | CN([C@H](c1ccccc1P(C(C)(C)C)C(C)(C)C)c1cccc2ccccc12)[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C30H42NOPS/c1-28(2,3)33(29(4,5)6)26-21-14-13-19-25(26)27(31(10)34(32)30(7,8)9)24-20-15-17-22-16-11-12-18-23(22)24/h11-21,27H,1-10H3/t27-,34+/m0/s1 |
| InChIKey | IQYXPXYFJPUPIE-NDOVKIIASA-N |
| XLogP | 8.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|