C17H23N — CID 102257505
(1R)-N,N,2,2-tetramethyl-1-naphthalen-1-ylpropan-1-amine (PubChem CID 102257505) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (1R)-N,N,2,2-tetramethyl-1-naphthalen-1-ylpropan-1-amine.
| Compound Name | (1R)-N,N,2,2-tetramethyl-1-naphthalen-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 102257505 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (1R)-N,N,2,2-tetramethyl-1-naphthalen-1-ylpropan-1-amine |
| SMILES | CN(C)[C@@H](c1cccc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C17H23N/c1-17(2,3)16(18(4)5)15-12-8-10-13-9-6-7-11-14(13)15/h6-12,16H,1-5H3/t16-/m0/s1 |
| InChIKey | QWILTMZDYIFEHF-INIZCTEOSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |