C20H30O — CID 144559923
methanol;1-(2,2,5-trimethylhexan-3-yl)naphthalene (PubChem CID 144559923) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is methanol;1-(2,2,5-trimethylhexan-3-yl)naphthalene.
| Compound Name | methanol;1-(2,2,5-trimethylhexan-3-yl)naphthalene |
|---|---|
| PubChem CID | 144559923 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | methanol;1-(2,2,5-trimethylhexan-3-yl)naphthalene |
| SMILES | CC(C)CC(c1cccc2ccccc12)C(C)(C)C.CO |
| InChI | InChI=1S/C19H26.CH4O/c1-14(2)13-18(19(3,4)5)17-12-8-10-15-9-6-7-11-16(15)17;1-2/h6-12,14,18H,13H2,1-5H3;2H,1H3 |
| InChIKey | LEUMVSUUSOPHSC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |