C25H30NOPS — CID 163340342
(R)-N-[(1R)-2-diphenylphosphanyl-1-phenylethyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 163340342) has the molecular formula C25H30NOPS and a molecular weight of 423.56 g/mol. Its IUPAC name is (R)-N-[(1R)-2-diphenylphosphanyl-1-phenylethyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-2-diphenylphosphanyl-1-phenylethyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163340342 |
| Molecular Formula | C25H30NOPS |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (R)-N-[(1R)-2-diphenylphosphanyl-1-phenylethyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | CN([C@@H](CP(c1ccccc1)c1ccccc1)c1ccccc1)[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C25H30NOPS/c1-25(2,3)29(27)26(4)24(21-14-8-5-9-15-21)20-28(22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-19,24H,20H2,1-4H3/t24-,29+/m0/s1 |
| InChIKey | OUMOIKKJQPXFKP-PWUYWRBVSA-N |
| XLogP | 5.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|