C26H40NO2PS — CID 162393889
N-[(R)-(2-ditert-butylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 162393889) has the molecular formula C26H40NO2PS and a molecular weight of 461.65 g/mol. Its IUPAC name is N-[(R)-(2-ditert-butylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(R)-(2-ditert-butylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162393889 |
| Molecular Formula | C26H40NO2PS |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[(R)-(2-ditert-butylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1ccc([C@@H](NS(=O)C(C)(C)C)c2ccccc2P(C(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H40NO2PS/c1-24(2,3)30(25(4,5)6)22-14-12-11-13-21(22)23(27-31(28)26(7,8)9)19-15-17-20(29-10)18-16-19/h11-18,23,27H,1-10H3/t23-,31?/m1/s1 |
| InChIKey | UGRJOEZRWKQFBQ-WNEYBHKTSA-N |
| XLogP | 6.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|