C42H44FeP2-6 — CID 87241826
[2-tert-butyl-3,4-diphenyl-5-(phosphanylmethyl)cyclopenta-2,4-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron (PubChem CID 87241826) has the molecular formula C42H44FeP2-6 and a molecular weight of 666.61 g/mol. Its IUPAC name is [2-tert-butyl-3,4-diphenyl-5-(phosphanylmethyl)cyclopenta-2,4-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron.
| Compound Name | [2-tert-butyl-3,4-diphenyl-5-(phosphanylmethyl)cyclopenta-2,4-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 87241826 |
| Molecular Formula | C42H44FeP2-6 |
| Molecular Weight | 666.61 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | [2-tert-butyl-3,4-diphenyl-5-(phosphanylmethyl)cyclopenta-2,4-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron |
| SMILES | Cc1ccccc1P(C[c-]1c(CP)c(-c2ccccc2)c(-c2ccccc2)c1C(C)(C)C)c1ccccc1C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C37H39P2.C5H5.Fe/c1-26-16-12-14-22-32(26)39(33-23-15-13-17-27(33)2)25-31-30(24-38)34(28-18-8-6-9-19-28)35(36(31)37(3,4)5)29-20-10-7-11-21-29;1-2-4-5-3-1;/h6-23H,24-25,38H2,1-5H3;1-5H;/q-1;-5; |
| InChIKey | MVCVMMHZFAVBAH-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.61 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|