C22H19FeP — CID 140891390
cyclopenta-1,3-diene;(2,3-diphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+) (PubChem CID 140891390) has the molecular formula C22H19FeP and a molecular weight of 370.21 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(2,3-diphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;(2,3-diphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+) |
|---|---|
| PubChem CID | 140891390 |
| Molecular Formula | C22H19FeP |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | cyclopenta-1,3-diene;(2,3-diphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+) |
| SMILES | P[c-]1ccc(-c2ccccc2)c1-c1ccccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C17H14P.C5H5.Fe/c18-16-12-11-15(13-7-3-1-4-8-13)17(16)14-9-5-2-6-10-14;1-2-4-5-3-1;/h1-12H,18H2;1-5H;/q2*-1;+2 |
| InChIKey | DEBPNOWFJLEATB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|