C30H50Fe — CID 158424496
1,2-dibutylcyclopenta-1,3-diene;iron(2+);1,2,5-tributylcyclopenta-1,3-diene (PubChem CID 158424496) has the molecular formula C30H50Fe and a molecular weight of 466.58 g/mol. Its IUPAC name is 1,2-dibutylcyclopenta-1,3-diene;iron(2+);1,2,5-tributylcyclopenta-1,3-diene.
| Compound Name | 1,2-dibutylcyclopenta-1,3-diene;iron(2+);1,2,5-tributylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 158424496 |
| Molecular Formula | C30H50Fe |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 1,2-dibutylcyclopenta-1,3-diene;iron(2+);1,2,5-tributylcyclopenta-1,3-diene |
| SMILES | CCCCc1cc[c-](CCCC)c1CCCC.CCCCc1cc[cH-]c1CCCC.[Fe+2] |
| InChI | InChI=1S/C17H29.C13H21.Fe/c1-4-7-10-15-13-14-16(11-8-5-2)17(15)12-9-6-3;1-3-5-8-12-10-7-11-13(12)9-6-4-2;/h13-14H,4-12H2,1-3H3;7,10-11H,3-6,8-9H2,1-2H3;/q2*-1;+2 |
| InChIKey | HAWQYZWOMKUHJF-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|