C42H74Cl2Ti-2 — CID 142725525
dichlorotitanium;bis(1,2,3,5-tetrabutylcyclopenta-1,3-diene) (PubChem CID 142725525) has the molecular formula C42H74Cl2Ti-2 and a molecular weight of 697.83 g/mol. Its IUPAC name is dichlorotitanium;bis(1,2,3,5-tetrabutylcyclopenta-1,3-diene).
| Compound Name | dichlorotitanium;bis(1,2,3,5-tetrabutylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 142725525 |
| Molecular Formula | C42H74Cl2Ti-2 |
| Molecular Weight | 697.83 g/mol |
| Exact Mass | 696.47 |
| IUPAC Name | dichlorotitanium;bis(1,2,3,5-tetrabutylcyclopenta-1,3-diene) |
| SMILES | CCCCc1c[c-](CCCC)c(CCCC)c1CCCC.CCCCc1c[c-](CCCC)c(CCCC)c1CCCC.Cl[Ti]Cl |
| InChI | InChI=1S/2C21H37.2ClH.Ti/c2*1-5-9-13-18-17-19(14-10-6-2)21(16-12-8-4)20(18)15-11-7-3;;;/h2*17H,5-16H2,1-4H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | NRKLYQUNYKXQTI-UHFFFAOYSA-L |
| XLogP | 14.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.83 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|