C34H48P2Ti — CID 21096598
bis(dibutyl(1H-inden-1-id-2-yl)phosphane);titanium(2+) (PubChem CID 21096598) has the molecular formula C34H48P2Ti and a molecular weight of 566.57 g/mol. Its IUPAC name is bis(dibutyl(1H-inden-1-id-2-yl)phosphane);titanium(2+).
| Compound Name | bis(dibutyl(1H-inden-1-id-2-yl)phosphane);titanium(2+) |
|---|---|
| PubChem CID | 21096598 |
| Molecular Formula | C34H48P2Ti |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | bis(dibutyl(1H-inden-1-id-2-yl)phosphane);titanium(2+) |
| SMILES | CCCCP(CCCC)c1cc2ccccc2[cH-]1.CCCCP(CCCC)c1cc2ccccc2[cH-]1.[Ti+2] |
| InChI | InChI=1S/2C17H24P.Ti/c2*1-3-5-11-18(12-6-4-2)17-13-15-9-7-8-10-16(15)14-17;/h2*7-10,13-14H,3-6,11-12H2,1-2H3;/q2*-1;+2 |
| InChIKey | JSXAOQBWSFLCCT-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|