About bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+)
bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) (PubChem CID 21096581) has the molecular formula C22H24P2Ti
and a molecular weight of 398.25 g/mol. Its IUPAC name is bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+).
Molecular Properties
| Compound Name | bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) |
| PubChem CID | 21096581 |
| Molecular Formula | C22H24P2Ti |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) |
| SMILES | CP(C)c1cc2ccccc2[cH-]1.CP(C)c1cc2ccccc2[cH-]1.[Ti+2] |
| InChI | InChI=1S/2C11H12P.Ti/c2*1-12(2)11-7-9-5-3-4-6-10(9)8-11;/h2*3-8H,1-2H3;/q2*-1;+2 |
| InChIKey | QDYCFVRLLSPSNJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+)?
The IUPAC name of bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) (CID 21096581) is bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+).
What is the SMILES notation for bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+)?
The canonical SMILES for bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) is CP(C)c1cc2ccccc2[cH-]1.CP(C)c1cc2ccccc2[cH-]1.[Ti+2].
What is the InChIKey of bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+)?
The InChIKey is QDYCFVRLLSPSNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H12P.Ti/c2*1-12(2)11-7-9-5-3-4-6-10(9)8-11;/h2*3-8H,1-2H3;/q2*-1;+2.
What are the key properties of bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+)?
bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) has a molecular weight of 398.25 g/mol, XLogP of 5.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-inden-1-id-2-yl(dimethyl)phosphane);titanium(2+) is sourced from PubChem (CID 21096581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).