About 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+)
9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) (PubChem CID 87829462) has the molecular formula C24H21PZr
and a molecular weight of 431.63 g/mol. Its IUPAC name is 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+).
Molecular Properties
| Compound Name | 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) |
| PubChem CID | 87829462 |
| Molecular Formula | C24H21PZr |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) |
| SMILES | CP(C)c1cc2ccccc2[cH-]1.[Zr+2].c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C11H12P.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-12(2)11-7-9-5-3-4-6-10(9)8-11;/h1-9H;3-8H,1-2H3;/q2*-1;+2 |
| InChIKey | MDYJWTMIUDLAAA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+)?
The IUPAC name of 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) (CID 87829462) is 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+).
What is the SMILES notation for 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+)?
The canonical SMILES for 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) is CP(C)c1cc2ccccc2[cH-]1.[Zr+2].c1ccc2c(c1)[cH-]c1ccccc12.
What is the InChIKey of 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+)?
The InChIKey is MDYJWTMIUDLAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9.C11H12P.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-12(2)11-7-9-5-3-4-6-10(9)8-11;/h1-9H;3-8H,1-2H3;/q2*-1;+2.
What are the key properties of 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+)?
9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) has a molecular weight of 431.63 g/mol, XLogP of 6.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ide;1H-inden-1-id-2-yl(dimethyl)phosphane;zirconium(2+) is sourced from PubChem (CID 87829462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).