C16H17Cl2PTi-2 — CID 154437007
cyclopenta-1,3-diene;dichlorotitanium;1H-inden-1-id-2-yl(dimethyl)phosphane (PubChem CID 154437007) has the molecular formula C16H17Cl2PTi-2 and a molecular weight of 359.06 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichlorotitanium;1H-inden-1-id-2-yl(dimethyl)phosphane.
| Compound Name | cyclopenta-1,3-diene;dichlorotitanium;1H-inden-1-id-2-yl(dimethyl)phosphane |
|---|---|
| PubChem CID | 154437007 |
| Molecular Formula | C16H17Cl2PTi-2 |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | cyclopenta-1,3-diene;dichlorotitanium;1H-inden-1-id-2-yl(dimethyl)phosphane |
| SMILES | CP(C)c1cc2ccccc2[cH-]1.Cl[Ti]Cl.c1cc[cH-]c1 |
| InChI | InChI=1S/C11H12P.C5H5.2ClH.Ti/c1-12(2)11-7-9-5-3-4-6-10(9)8-11;1-2-4-5-3-1;;;/h3-8H,1-2H3;1-5H;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | YEMVJVMABSNMME-UHFFFAOYSA-L |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|