About cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide
cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide (PubChem CID 154426269) has the molecular formula C17H18Cl2Zr
and a molecular weight of 384.46 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide |
| PubChem CID | 154426269 |
| Molecular Formula | C17H18Cl2Zr |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide |
| SMILES | CCCc1cc2ccccc2[cH-]1.Cl[Zr+2]Cl.c1cc[cH-]c1 |
| InChI | InChI=1S/C12H13.C5H5.2ClH.Zr/c1-2-5-10-8-11-6-3-4-7-12(11)9-10;1-2-4-5-3-1;;;/h3-4,6-9H,2,5H2,1H3;1-5H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | LVFGLGBTBAIEAN-UHFFFAOYSA-L |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide?
The IUPAC name of cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide (CID 154426269) is cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide.
What is the SMILES notation for cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide?
The canonical SMILES for cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide is CCCc1cc2ccccc2[cH-]1.Cl[Zr+2]Cl.c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide?
The InChIKey is LVFGLGBTBAIEAN-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H13.C5H5.2ClH.Zr/c1-2-5-10-8-11-6-3-4-7-12(11)9-10;1-2-4-5-3-1;;;/h3-4,6-9H,2,5H2,1H3;1-5H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide?
cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide has a molecular weight of 384.46 g/mol, XLogP of 6.29, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;dichlorozirconium(2+);2-propyl-1H-inden-1-ide is sourced from PubChem (CID 154426269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).