About 2-butyl-1H-inden-1-ide;titanium(3+);diiodide
2-butyl-1H-inden-1-ide;titanium(3+);diiodide (PubChem CID 174711476) has the molecular formula C13H15I2Ti
and a molecular weight of 472.94 g/mol. Its IUPAC name is 2-butyl-1H-inden-1-ide;titanium(3+);diiodide.
Molecular Properties
| Compound Name | 2-butyl-1H-inden-1-ide;titanium(3+);diiodide |
| PubChem CID | 174711476 |
| Molecular Formula | C13H15I2Ti |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.87 |
| IUPAC Name | 2-butyl-1H-inden-1-ide;titanium(3+);diiodide |
| SMILES | CCCCc1cc2ccccc2[cH-]1.[I-].[I-].[Ti+3] |
| InChI | InChI=1S/C13H15.2HI.Ti/c1-2-3-6-11-9-12-7-4-5-8-13(12)10-11;;;/h4-5,7-10H,2-3,6H2,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | HPFPIDCHFOGFGV-UHFFFAOYSA-L |
| XLogP | -2.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1H-inden-1-ide;titanium(3+);diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1H-inden-1-ide;titanium(3+);diiodide?
The IUPAC name of 2-butyl-1H-inden-1-ide;titanium(3+);diiodide (CID 174711476) is 2-butyl-1H-inden-1-ide;titanium(3+);diiodide.
What is the SMILES notation for 2-butyl-1H-inden-1-ide;titanium(3+);diiodide?
The canonical SMILES for 2-butyl-1H-inden-1-ide;titanium(3+);diiodide is CCCCc1cc2ccccc2[cH-]1.[I-].[I-].[Ti+3].
What is the InChIKey of 2-butyl-1H-inden-1-ide;titanium(3+);diiodide?
The InChIKey is HPFPIDCHFOGFGV-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H15.2HI.Ti/c1-2-3-6-11-9-12-7-4-5-8-13(12)10-11;;;/h4-5,7-10H,2-3,6H2,1H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of 2-butyl-1H-inden-1-ide;titanium(3+);diiodide?
2-butyl-1H-inden-1-ide;titanium(3+);diiodide has a molecular weight of 472.94 g/mol, XLogP of -2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1H-inden-1-ide;titanium(3+);diiodide is sourced from PubChem (CID 174711476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).