About 2-butyl-1H-inden-1-ide;chromium
2-butyl-1H-inden-1-ide;chromium (PubChem CID 150230338) has the molecular formula C13H15Cr-
and a molecular weight of 223.26 g/mol. Its IUPAC name is 2-butyl-1H-inden-1-ide;chromium.
Molecular Properties
| Compound Name | 2-butyl-1H-inden-1-ide;chromium |
| PubChem CID | 150230338 |
| Molecular Formula | C13H15Cr- |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-butyl-1H-inden-1-ide;chromium |
| SMILES | CCCCc1cc2ccccc2[cH-]1.[Cr] |
| InChI | InChI=1S/C13H15.Cr/c1-2-3-6-11-9-12-7-4-5-8-13(12)10-11;/h4-5,7-10H,2-3,6H2,1H3;/q-1; |
| InChIKey | HSMFXCRFLZAGRF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1H-inden-1-ide;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1H-inden-1-ide;chromium?
The IUPAC name of 2-butyl-1H-inden-1-ide;chromium (CID 150230338) is 2-butyl-1H-inden-1-ide;chromium.
What is the SMILES notation for 2-butyl-1H-inden-1-ide;chromium?
The canonical SMILES for 2-butyl-1H-inden-1-ide;chromium is CCCCc1cc2ccccc2[cH-]1.[Cr].
What is the InChIKey of 2-butyl-1H-inden-1-ide;chromium?
The InChIKey is HSMFXCRFLZAGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15.Cr/c1-2-3-6-11-9-12-7-4-5-8-13(12)10-11;/h4-5,7-10H,2-3,6H2,1H3;/q-1;.
What are the key properties of 2-butyl-1H-inden-1-ide;chromium?
2-butyl-1H-inden-1-ide;chromium has a molecular weight of 223.26 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1H-inden-1-ide;chromium is sourced from PubChem (CID 150230338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).