C22H24HfP2-2 — CID 87828607
hafnium;bis(1H-inden-1-id-2-yl(dimethyl)phosphane) (PubChem CID 87828607) has the molecular formula C22H24HfP2-2 and a molecular weight of 528.87 g/mol. Its IUPAC name is hafnium;bis(1H-inden-1-id-2-yl(dimethyl)phosphane).
| Compound Name | hafnium;bis(1H-inden-1-id-2-yl(dimethyl)phosphane) |
|---|---|
| PubChem CID | 87828607 |
| Molecular Formula | C22H24HfP2-2 |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | hafnium;bis(1H-inden-1-id-2-yl(dimethyl)phosphane) |
| SMILES | CP(C)c1cc2ccccc2[cH-]1.CP(C)c1cc2ccccc2[cH-]1.[Hf] |
| InChI | InChI=1S/2C11H12P.Hf/c2*1-12(2)11-7-9-5-3-4-6-10(9)8-11;/h2*3-8H,1-2H3;/q2*-1; |
| InChIKey | WFHFCWKVTVRXHG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|